5-(3-chlorophenyl)cyclohexane-1,3-dione structure
|
Common Name | 5-(3-chlorophenyl)cyclohexane-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 55579-71-0 | Molecular Weight | 222.66800 | |
| Density | 1.268g/cm3 | Boiling Point | 383.3ºC at 760 mmHg | |
| Molecular Formula | C12H11ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.1ºC | |
| Name | 5-(3-chlorophenyl)cyclohexane-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.268g/cm3 |
|---|---|
| Boiling Point | 383.3ºC at 760 mmHg |
| Molecular Formula | C12H11ClO2 |
| Molecular Weight | 222.66800 |
| Flash Point | 162.1ºC |
| Exact Mass | 222.04500 |
| PSA | 34.14000 |
| LogP | 2.74570 |
| Index of Refraction | 1.565 |
| InChIKey | YSNSALYPQQBIDC-UHFFFAOYSA-N |
| SMILES | O=C1CC(=O)CC(c2cccc(Cl)c2)C1 |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| hms563i13 |