5-benzoylpyran-2-one structure
|
Common Name | 5-benzoylpyran-2-one | ||
|---|---|---|---|---|
| CAS Number | 55588-79-9 | Molecular Weight | 200.19000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H8O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-benzoylpyran-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H8O3 |
|---|---|
| Molecular Weight | 200.19000 |
| Exact Mass | 200.04700 |
| PSA | 47.28000 |
| LogP | 1.87080 |
| InChIKey | RSMYYOYTUZKGLT-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)c1ccc(=O)oc1 |
|
~%
5-benzoylpyran-2-one CAS#:55588-79-9 |
| Literature: Wiley; Slaymaker Journal of the American Chemical Society, 1956 , vol. 78, p. 2393,2394 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-benzoyl-pyran-2-one |
| 2H-Pyran-2-one,5-benzoyl |
| 5-Benzoyl-2H-pyran-2-on |
| 5-Benzoyl-pyran-2-on |