(4-phenyldiazenylphenyl)methyl carbonochloridate structure
|
Common Name | (4-phenyldiazenylphenyl)methyl carbonochloridate | ||
|---|---|---|---|---|
| CAS Number | 55592-99-9 | Molecular Weight | 274.70200 | |
| Density | 1.22g/cm3 | Boiling Point | 402.8ºC at 760mmHg | |
| Molecular Formula | C14H11ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.4ºC | |
| Name | (4-phenyldiazenylphenyl)methyl carbonochloridate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 402.8ºC at 760mmHg |
| Molecular Formula | C14H11ClN2O2 |
| Molecular Weight | 274.70200 |
| Flash Point | 197.4ºC |
| Exact Mass | 274.05100 |
| PSA | 51.02000 |
| LogP | 4.97740 |
| Index of Refraction | 1.585 |
| InChIKey | SBPAKMOTHPSGDZ-UHFFFAOYSA-N |
| SMILES | O=C(Cl)OCc1ccc(N=Nc2ccccc2)cc1 |
|
~%
(4-phenyldiazen... CAS#:55592-99-9 |
| Literature: Harvey, Andrew J.; Abell, Andrew D. Bioorganic and Medicinal Chemistry Letters, 2001 , vol. 11, # 18 p. 2441 - 2444 |
|
~%
(4-phenyldiazen... CAS#:55592-99-9 |
| Literature: Schwyzer et al. Helvetica Chimica Acta, 1958 , vol. 41, p. 491,496 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| EINECS 259-719-5 |
| 4-Chlorcarbonyloxymethyl-azobenzol |
| p-Phenylazo-benzyloxycarbonylchlorid |