5,6,7-trimethoxy-1H-indole-2-carbonyl chloride structure
|
Common Name | 5,6,7-trimethoxy-1H-indole-2-carbonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 556038-52-9 | Molecular Weight | 269.68100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5,6,7-trimethoxy-1H-indole-2-carbonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H12ClNO4 |
|---|---|
| Molecular Weight | 269.68100 |
| Exact Mass | 269.04500 |
| PSA | 60.55000 |
| LogP | 2.57270 |
| InChIKey | ZTVNVZNWQKATRX-UHFFFAOYSA-N |
| SMILES | COc1cc2cc(C(=O)Cl)[nH]c2c(OC)c1OC |
|
~%
5,6,7-trimethox... CAS#:556038-52-9 |
| Literature: Yamada, Ken; Kurokawa, Toshiki; Tokuyama, Hidetoshi; Fukuyama, Tohru Journal of the American Chemical Society, 2003 , vol. 125, # 22 p. 6630 - 6631 |
|
~%
5,6,7-trimethox... CAS#:556038-52-9 |
| Literature: Yamada, Ken; Kurokawa, Toshiki; Tokuyama, Hidetoshi; Fukuyama, Tohru Journal of the American Chemical Society, 2003 , vol. 125, # 22 p. 6630 - 6631 |
|
~%
5,6,7-trimethox... CAS#:556038-52-9 |
| Literature: Yamada, Ken; Kurokawa, Toshiki; Tokuyama, Hidetoshi; Fukuyama, Tohru Journal of the American Chemical Society, 2003 , vol. 125, # 22 p. 6630 - 6631 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 5,6,7-trimethoxyindole-2-carbonyl chloride |
| 5,6,7-trimethoxyindole-2-carboxylic acid chloride |
| 1H-Indole-2-carbonyl chloride,5,6,7-trimethoxy |