(Tyr8)-Substance P
Modify Date: 2025-08-27 12:12:54
(Tyr8)-Substance P structure
|
Common Name | (Tyr8)-Substance P | ||
|---|---|---|---|---|
| CAS Number | 55614-10-3 | Molecular Weight | 1363.63000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C63H98N18O14S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of (Tyr8)-Substance P[Tyr8]-Substance P is an active peptide. [Tyr8]-Substance P can be used for the research of various biochemical[1]. |
| Name | arg-pro-lys-pro-gln-gln-phe-tyr-gly-leu-met-nh2 |
|---|---|
| Synonym | More Synonyms |
| Description | [Tyr8]-Substance P is an active peptide. [Tyr8]-Substance P can be used for the research of various biochemical[1]. |
|---|---|
| Related Catalog | |
| In Vitro | [Tyr8]-Substance P at a very high dosage released LH and FSH in vitro[1]. |
| In Vivo | [Tyr8]-Substance P shows the activity in contraction of the isolated guinea pig ileum and decrease in systemic blood pressure of dogs[1]. |
| References |
| Molecular Formula | C63H98N18O14S |
|---|---|
| Molecular Weight | 1363.63000 |
| Exact Mass | 1362.72000 |
| PSA | 562.16000 |
| LogP | 3.89970 |
| InChIKey | MSKLWPIJUANGPO-CUZNLEPHSA-N |
| SMILES | CSCCC(NC(=O)C(CC(C)C)NC(=O)CNC(=O)C(Cc1ccc(O)cc1)NC(=O)C(Cc1ccccc1)NC(=O)C(CCC(N)=O)NC(=O)C(CCC(N)=O)NC(=O)C1CCCN1C(=O)C(CCCCN)NC(=O)C1CCCN1C(=O)C(N)CCCN=C(N)N)C(N)=O |
| [Tyr8 ]-substance P |
| substance PTyr8 |
| L-Arg-L-Pro-L-Lys-L-Pro-L-Gln-L-Gln-L-Phe-L-Tyr-Gly-L-Leu-L-Met-NH2 |
| RPKPQQFYGLM-NH2 |