N-[2-(3,4-dimethoxyphenyl)ethyl]-3,5,6-trimethylimidazo[4,5-b]pyrazin-2-amine
Modify Date: 2025-08-26 12:05:26
![N-[2-(3,4-dimethoxyphenyl)ethyl]-3,5,6-trimethylimidazo[4,5-b]pyrazin-2-amine Structure](https://image.chemsrc.com/caspic/179/55635-70-6.png)
N-[2-(3,4-dimethoxyphenyl)ethyl]-3,5,6-trimethylimidazo[4,5-b]pyrazin-2-amine structure
|
Common Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-3,5,6-trimethylimidazo[4,5-b]pyrazin-2-amine | ||
|---|---|---|---|---|
| CAS Number | 55635-70-6 | Molecular Weight | 341.40800 | |
| Density | 1.24g/cm3 | Boiling Point | 509.1ºC at 760 mmHg | |
| Molecular Formula | C18H23N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 261.7ºC | |
| Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-3,5,6-trimethylimidazo[4,5-b]pyrazin-2-amine |
|---|
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 509.1ºC at 760 mmHg |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.40800 |
| Flash Point | 261.7ºC |
| Exact Mass | 341.18500 |
| PSA | 77.32000 |
| LogP | 2.07380 |
| Index of Refraction | 1.614 |
| InChIKey | HVYNUXBKWKUETH-UHFFFAOYSA-N |
| SMILES | COc1ccc(CCNc2nc3nc(C)c(C)nc3n2C)cc1OC |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |