ethyl 2-amino-1-methylindole-3-carboxylate
ethyl 2-amino-1-methylindole-3-carboxylate structure
|
Common Name | ethyl 2-amino-1-methylindole-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 55643-99-7 | Molecular Weight | 218.25200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 2-amino-1-methylindole-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H14N2O2 |
|---|---|
| Molecular Weight | 218.25200 |
| Exact Mass | 218.10600 |
| PSA | 57.25000 |
| LogP | 2.51840 |
| InChIKey | AGMJUSDWPNJOMS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(N)n(C)c2ccccc12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~90%
ethyl 2-amino-1... CAS#:55643-99-7 |
| Literature: Lauria, Antonino; Patella, Chiara; Diana, Patrizia; Barraja, Paola; Montalbano, Alessandra; Cirrincione, Girolamo; Dattolo, Gaetano; Almerico, Anna Maria Heterocycles, 2003 , vol. 60, # 12 p. 2669 - 2675 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1H-Indole-3-carboxylic acid,2-amino-1-methyl-,ethyl ester |
| 1-Methyl-2-amino-3-carbethoxyindol |
| ethyl 2-amino-1-methyl-1H-indole-3-carboxylate |
| 2-amino-1-methyl-indole-3-carboxylic acid ethyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does ethyl 2-amino-1-methylindole-3-carboxylate have? |
| A: English synonyms of ethyl 2-amino-1-methylindole-3-carboxylate: 1H-Indole-3-carboxylic acid,2-amino-1-methyl-,ethyl ester, 1-Methyl-2-amino-3-carbethoxyindol, ethyl 2-amino-1-methyl-1H-indole-3-carboxylate, 2-amino-1-methyl-indole-3-carboxylic acid ethyl ester. |
| Q: What is the InChIKey of ethyl 2-amino-1-methylindole-3-carboxylate? |
| A: InChIKey of ethyl 2-amino-1-methylindole-3-carboxylate is AGMJUSDWPNJOMS-UHFFFAOYSA-N. |
| Q: What is the LogP of ethyl 2-amino-1-methylindole-3-carboxylate? |
| A: LogP of ethyl 2-amino-1-methylindole-3-carboxylate is 2.51840. |
| Q: What is the polar surface area (PSA) of ethyl 2-amino-1-methylindole-3-carboxylate? |
| A: Polar surface area (PSA) of ethyl 2-amino-1-methylindole-3-carboxylate is 57.25000. |
| Q: What is the molecular formula of ethyl 2-amino-1-methylindole-3-carboxylate? |
| A: Molecular formula of ethyl 2-amino-1-methylindole-3-carboxylate is C12H14N2O2. |
| Q: What is the Chinese name of 55643-99-7? |
| A: Chinese name of 55643-99-7 is 55643-99-7. |
| Q: What is the English name of ethyl 2-amino-1-methylindole-3-carboxylate? |
| A: The English name of ethyl 2-amino-1-methylindole-3-carboxylate is ethyl 2-amino-1-methylindole-3-carboxylate. |
| Q: What is the molecular weight of ethyl 2-amino-1-methylindole-3-carboxylate? |
| A: Molecular weight of ethyl 2-amino-1-methylindole-3-carboxylate is 218.25200. |
| Q: What is the CAS number of ethyl 2-amino-1-methylindole-3-carboxylate? |
| A: CAS number of ethyl 2-amino-1-methylindole-3-carboxylate is 55643-99-7. |
| Q: What is the SMILES notation of ethyl 2-amino-1-methylindole-3-carboxylate? |
| A: SMILES notation of ethyl 2-amino-1-methylindole-3-carboxylate is CCOC(=O)c1c(N)n(C)c2ccccc12. |