2,6-diacetyl-7,9-dihydroxy-8,9b-dimethyldibenzofuran-1,3(2H,9bH)-dione, compound with 2,2',2''-nitrilotriethanol (1:1) structure
|
Common Name | 2,6-diacetyl-7,9-dihydroxy-8,9b-dimethyldibenzofuran-1,3(2H,9bH)-dione, compound with 2,2',2''-nitrilotriethanol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 55648-03-8 | Molecular Weight | 493.50400 | |
| Density | N/A | Boiling Point | 594.8ºC at 760 mmHg | |
| Molecular Formula | C24H31NO10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.1ºC | |
| Name | 2-[bis(2-hydroxyethyl)amino]ethanol,2,6-diacetyl-7,9-dihydroxy-8,9b-dimethyldibenzofuran-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 594.8ºC at 760 mmHg |
|---|---|
| Molecular Formula | C24H31NO10 |
| Molecular Weight | 493.50400 |
| Flash Point | 219.1ºC |
| Exact Mass | 493.19500 |
| PSA | 181.90000 |
| InChIKey | RULZVYDQGSZNRR-UHFFFAOYSA-N |
| SMILES | CC(=O)c1c(O)c(C)c(O)c2c1OC1=CC(=O)C(C(C)=O)C(=O)C12C.OCCN(CCO)CCO |
| einecs 259-738-9 |