3-(4-Bromophenyl)-1,2,3-benzotriazin-4(3H)-one structure
|
Common Name | 3-(4-Bromophenyl)-1,2,3-benzotriazin-4(3H)-one | ||
|---|---|---|---|---|
| CAS Number | 55649-80-4 | Molecular Weight | 302.12600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H8BrN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(4-bromophenyl)-1,2,3-benzotriazin-4-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H8BrN3O |
|---|---|
| Molecular Weight | 302.12600 |
| Exact Mass | 300.98500 |
| PSA | 47.78000 |
| LogP | 2.54320 |
| InChIKey | CXBNGMLYZXDWOG-UHFFFAOYSA-N |
| SMILES | O=c1c2ccccc2nnn1-c1ccc(Br)cc1 |
|
~%
3-(4-Bromopheny... CAS#:55649-80-4 |
| Literature: Chattaway; Walker Journal of the Chemical Society, 1927 , p. 329 |
|
~%
3-(4-Bromopheny... CAS#:55649-80-4 |
| Literature: Chattaway; Walker Journal of the Chemical Society, 1927 , p. 329 |
|
~%
3-(4-Bromopheny... CAS#:55649-80-4 |
| Literature: Chattaway; Walker Journal of the Chemical Society, 1927 , p. 329 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-p-Bromphenyl-1,2,3-benzotriazin-4-on |