4-Methoxy-2,6-dimethylbenzenesulfonyl Chloride structure
|
Common Name | 4-Methoxy-2,6-dimethylbenzenesulfonyl Chloride | ||
|---|---|---|---|---|
| CAS Number | 55661-08-0 | Molecular Weight | 234.70000 | |
| Density | 1.285 | Boiling Point | 356.097ºC at 760 mmHg | |
| Molecular Formula | C9H11ClO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-Methoxy-2,6-dimethylbenzenesulfonyl Chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.285 |
|---|---|
| Boiling Point | 356.097ºC at 760 mmHg |
| Molecular Formula | C9H11ClO3S |
| Molecular Weight | 234.70000 |
| Exact Mass | 234.01200 |
| PSA | 51.75000 |
| LogP | 3.32030 |
| Index of Refraction | 1.525 |
| InChIKey | FARJAHHRGCAAOY-UHFFFAOYSA-N |
| SMILES | COc1cc(C)c(S(=O)(=O)Cl)c(C)c1 |
| HS Code | 2909309090 |
|---|
|
~94%
4-Methoxy-2,6-d... CAS#:55661-08-0 |
| Literature: Gruenenthal GmbH Patent: US2010/234340 A1, 2010 ; Location in patent: Page/Page column 23-24 ; US 20100234340 A1 |
|
~36%
4-Methoxy-2,6-d... CAS#:55661-08-0 |
| Literature: Gruenenthal GmbH Patent: US2008/153843 A1, 2008 ; Location in patent: Page/Page column 38 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| MFCD00210327 |