N,N-dimethyl-2-phenothiazin-10-ylpropan-1-amine,hydrochloride structure
|
Common Name | N,N-dimethyl-2-phenothiazin-10-ylpropan-1-amine,hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 5568-90-1 | Molecular Weight | 320.88000 | |
| Density | N/A | Boiling Point | 403.4ºC at 760 mmHg | |
| Molecular Formula | C17H21ClN2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.8ºC | |
| Name | N,N-dimethyl-2-phenothiazin-10-ylpropan-1-amine,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 403.4ºC at 760 mmHg |
|---|---|
| Molecular Formula | C17H21ClN2S |
| Molecular Weight | 320.88000 |
| Flash Point | 197.8ºC |
| Exact Mass | 320.11100 |
| PSA | 31.78000 |
| LogP | 5.10640 |
| InChIKey | RISCHQYUHLQSBU-UHFFFAOYSA-N |
| SMILES | CC(CN(C)C)N1c2ccccc2Sc2ccccc21.Cl |
| HS Code | 2934300000 |
|---|
|
~74%
N,N-dimethyl-2-... CAS#:5568-90-1 |
| Literature: Fry Jr.; Maienthal; Benson Journal of Pharmaceutical Sciences, 1983 , vol. 72, # 5 p. 568 - 569 |
|
~%
N,N-dimethyl-2-... CAS#:5568-90-1 |
| Literature: Journal of Pharmaceutical Sciences, , vol. 72, # 5 p. 568 - 569 |
|
~%
N,N-dimethyl-2-... CAS#:5568-90-1 |
| Literature: Journal of Pharmaceutical Sciences, , vol. 72, # 5 p. 568 - 569 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934300000 |
|---|---|
| Summary | 2934300000. other compounds containing in the structure a phenothiazine ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Diprazin hydrochloride |
| Iso Promethazine Hydrochloride |
| Isopromethazine HCl |
| Promethazin-Hydrochlorid |