3-(PIPERAZIN-1-YL)QUINOXALIN-2(1H)-ONE structure
|
Common Name | 3-(PIPERAZIN-1-YL)QUINOXALIN-2(1H)-ONE | ||
|---|---|---|---|---|
| CAS Number | 55686-32-3 | Molecular Weight | 230.26600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-piperazin-1-yl-1H-quinoxalin-2-one |
|---|
| Molecular Formula | C12H14N4O |
|---|---|
| Molecular Weight | 230.26600 |
| Exact Mass | 230.11700 |
| PSA | 61.02000 |
| LogP | 0.72650 |
| InChIKey | VBHKPSBTQOQTHK-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c2ccccc2nc1N1CCNCC1 |
| HS Code | 2933990090 |
|---|
|
~%
3-(PIPERAZIN-1-... CAS#:55686-32-3 |
| Literature: Lumma Jr.; Hartman; Saari; Engelhardt; Lotti; Stone Journal of Medicinal Chemistry, 1981 , vol. 24, # 1 p. 93 - 101 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |