(Z)-4-phenyl-2-pyridin-4-ylbut-3-en-2-ol structure
|
Common Name | (Z)-4-phenyl-2-pyridin-4-ylbut-3-en-2-ol | ||
|---|---|---|---|---|
| CAS Number | 55690-12-5 | Molecular Weight | 225.28600 | |
| Density | 1.13g/cm3 | Boiling Point | 410.3ºC at 760 mmHg | |
| Molecular Formula | C15H15NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.9ºC | |
| Name | (Z)-4-phenyl-2-pyridin-4-ylbut-3-en-2-ol |
|---|
| Density | 1.13g/cm3 |
|---|---|
| Boiling Point | 410.3ºC at 760 mmHg |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.28600 |
| Flash Point | 201.9ºC |
| Exact Mass | 225.11500 |
| PSA | 33.12000 |
| LogP | 3.00250 |
| Index of Refraction | 1.625 |
| InChIKey | ZEAHWXBLUPWCDY-YFHOEESVSA-N |
| SMILES | CC(O)(C=Cc1ccccc1)c1ccncc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |