3-methyl-1,5-diphenylpyrazol-4-ol structure
|
Common Name | 3-methyl-1,5-diphenylpyrazol-4-ol | ||
|---|---|---|---|---|
| CAS Number | 55697-81-9 | Molecular Weight | 250.29500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H14N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-methyl-1,5-diphenylpyrazol-4-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H14N2O |
|---|---|
| Molecular Weight | 250.29500 |
| Exact Mass | 250.11100 |
| PSA | 38.05000 |
| LogP | 3.55330 |
| InChIKey | IXDPXBWYDUACPS-UHFFFAOYSA-N |
| SMILES | Cc1nn(-c2ccccc2)c(-c2ccccc2)c1O |
|
~46%
3-methyl-1,5-di... CAS#:55697-81-9 |
| Literature: Begtrup, Mikael; Nytoft, Hans Peter Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1985 , p. 81 - 86 |
|
~%
3-methyl-1,5-di... CAS#:55697-81-9 |
| Literature: Boehme; Schneider Chemische Berichte, 1958 , vol. 91, p. 1100,1105 |
|
~%
3-methyl-1,5-di... CAS#:55697-81-9 |
| Literature: Boehme; Schneider Chemische Berichte, 1958 , vol. 91, p. 1100,1105 |
|
~%
3-methyl-1,5-di... CAS#:55697-81-9 |
| Literature: Boehme; Schneider Chemische Berichte, 1958 , vol. 91, p. 1100,1105 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1H-Pyrazol-4-ol,3-methyl-1,5-diphenyl |
| 3-methyl-1,5-diphenyl-1H-pyrazol-4-ol |
| 4-hydroxy-3-methyl-1,5-diphenylpyrazole |