Benzeneacetonitrile,4-(1,1-dimethylethyl)-3-hydroxy-2,6-dimethyl- structure
|
Common Name | Benzeneacetonitrile,4-(1,1-dimethylethyl)-3-hydroxy-2,6-dimethyl- | ||
|---|---|---|---|---|
| CAS Number | 55699-10-0 | Molecular Weight | 217.30700 | |
| Density | 1.018g/cm3 | Boiling Point | 341.3ºC at 760 mmHg | |
| Molecular Formula | C14H19NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 160.2ºC | |
| Name | 2-(4-tert-Butyl-3-hydroxy-2,6-dimethylphenyl)acetonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.018g/cm3 |
|---|---|
| Boiling Point | 341.3ºC at 760 mmHg |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.30700 |
| Flash Point | 160.2ºC |
| Exact Mass | 217.14700 |
| PSA | 44.02000 |
| LogP | 3.37258 |
| Index of Refraction | 1.527 |
| InChIKey | OUKJZHRCKQJXSU-UHFFFAOYSA-N |
| SMILES | Cc1cc(C(C)(C)C)c(O)c(C)c1CC#N |
| HS Code | 2926909090 |
|---|
|
~92%
Benzeneacetonit... CAS#:55699-10-0 |
| Literature: Raju, B.; Rao, G. S. Krishna Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1987 , vol. 26, # 1-12 p. 469 - 470 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Einecs 259-766-1 |
| 4-(1,1-Dimethylethyl)-3-hydroxy-2,6-dimethylbenzeneacetonitrile |
| 3-Hydroxy-4-(1,1-dimethylethyl)-2,6-dimethyl benzeneacetonitrile |
| 4-tert-butyl-3-hydroxy-2,6-xylylacetonitrile |
| 2,6-dimethyl-3-hydroxy-4-t-butylphenylacetonitrile |
| 4-t-butyl-2,6-dimethyl-3-hydroxy-1-phenylacetonitrile |
| 4-TERT-BUTYL-2,6-DIMETHYL-3-HYDROXY PHENYLACETONITRILE |
| 4-tert-Butyl-3-hydroxy-2,6-dimethylphenylacetonitrile |
| Benzeneacetonitrile,4-(1,1-diMethylethyl)-3-hydroxy-2,6-diMethyl |