2,4-dimethyl-3-propan-2-ylpentan-3-ol,4-nitrobenzoic acid structure
|
Common Name | 2,4-dimethyl-3-propan-2-ylpentan-3-ol,4-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 55705-73-2 | Molecular Weight | 325.40000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H27NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,4-dimethyl-3-propan-2-ylpentan-3-ol,4-nitrobenzoic acid |
|---|
| Molecular Formula | C17H27NO5 |
|---|---|
| Molecular Weight | 325.40000 |
| Exact Mass | 325.18900 |
| PSA | 103.35000 |
| LogP | 4.50170 |
| InChIKey | GEVATHJWARARJL-UHFFFAOYSA-N |
| SMILES | CC(C)C(O)(C(C)C)C(C)C.O=C(O)c1ccc([N+](=O)[O-])cc1 |
|
~%
2,4-dimethyl-3-... CAS#:55705-73-2 |
| Literature: Bartlett; Stiles Journal of the American Chemical Society, 1955 , vol. 77, p. 2806,2811 |
|
~%
2,4-dimethyl-3-... CAS#:55705-73-2 |
| Literature: Duismann,W. et al. Justus Liebigs Annalen der Chemie, 1976 , p. 1820 - 1833 |