2,4-dimethyl-3-propan-2-ylpentan-3-ol,4-nitrobenzoic acid
2,4-dimethyl-3-propan-2-ylpentan-3-ol,4-nitrobenzoic acid structure
|
Common Name | 2,4-dimethyl-3-propan-2-ylpentan-3-ol,4-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 55705-73-2 | Molecular Weight | 325.40000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H27NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,4-dimethyl-3-propan-2-ylpentan-3-ol,4-nitrobenzoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H27NO5 |
|---|---|
| Molecular Weight | 325.40000 |
| Exact Mass | 325.18900 |
| PSA | 103.35000 |
| LogP | 4.50170 |
| InChIKey | GEVATHJWARARJL-UHFFFAOYSA-N |
| SMILES | CC(C)C(O)(C(C)C)C(C)C.O=C(O)c1ccc([N+](=O)[O-])cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2,4-dimethyl-3-... CAS#:55705-73-2 |
| Literature: Bartlett; Stiles Journal of the American Chemical Society, 1955 , vol. 77, p. 2806,2811 |
|
~%
2,4-dimethyl-3-... CAS#:55705-73-2 |
| Literature: Duismann,W. et al. Justus Liebigs Annalen der Chemie, 1976 , p. 1820 - 1833 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 2,4-dimethyl-3-propan-2-ylpentan-3-ol,4-nitrobenzoic acid? |
| A: Polar surface area (PSA) of 2,4-dimethyl-3-propan-2-ylpentan-3-ol,4-nitrobenzoic acid is 103.35000. |
| Q: What is the English name of 2,4-dimethyl-3-propan-2-ylpentan-3-ol,4-nitrobenzoic acid? |
| A: The English name of 2,4-dimethyl-3-propan-2-ylpentan-3-ol,4-nitrobenzoic acid is 2,4-dimethyl-3-propan-2-ylpentan-3-ol,4-nitrobenzoic acid. |
| Q: What is the LogP of 2,4-dimethyl-3-propan-2-ylpentan-3-ol,4-nitrobenzoic acid? |
| A: LogP of 2,4-dimethyl-3-propan-2-ylpentan-3-ol,4-nitrobenzoic acid is 4.50170. |
| Q: What is the InChIKey of 2,4-dimethyl-3-propan-2-ylpentan-3-ol,4-nitrobenzoic acid? |
| A: InChIKey of 2,4-dimethyl-3-propan-2-ylpentan-3-ol,4-nitrobenzoic acid is GEVATHJWARARJL-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2,4-dimethyl-3-propan-2-ylpentan-3-ol,4-nitrobenzoic acid? |
| A: Molecular weight of 2,4-dimethyl-3-propan-2-ylpentan-3-ol,4-nitrobenzoic acid is 325.40000. |
| Q: What is the Chinese name of 55705-73-2? |
| A: Chinese name of 55705-73-2 is 55705-73-2. |
| Q: What is the SMILES notation of 2,4-dimethyl-3-propan-2-ylpentan-3-ol,4-nitrobenzoic acid? |
| A: SMILES notation of 2,4-dimethyl-3-propan-2-ylpentan-3-ol,4-nitrobenzoic acid is CC(C)C(O)(C(C)C)C(C)C.O=C(O)c1ccc([N+](=O)[O-])cc1. |
| Q: What is the CAS number of 2,4-dimethyl-3-propan-2-ylpentan-3-ol,4-nitrobenzoic acid? |
| A: CAS number of 2,4-dimethyl-3-propan-2-ylpentan-3-ol,4-nitrobenzoic acid is 55705-73-2. |
| Q: What is the molecular formula of 2,4-dimethyl-3-propan-2-ylpentan-3-ol,4-nitrobenzoic acid? |
| A: Molecular formula of 2,4-dimethyl-3-propan-2-ylpentan-3-ol,4-nitrobenzoic acid is C17H27NO5. |
| Q: What are the upstream materials of 2,4-dimethyl-3-propan-2-ylpentan-3-ol,4-nitrobenzoic acid? |
| A: Related upstream materials(CAS) of 2,4-dimethyl-3-propan-2-ylpentan-3-ol,4-nitrobenzoic acid: 1888-75-1;565-80-0;51200-83-0;122-04-3. |