1-(9H-FLUOREN-3-YL)-ETHANONE structure
|
Common Name | 1-(9H-FLUOREN-3-YL)-ETHANONE | ||
|---|---|---|---|---|
| CAS Number | 55718-48-4 | Molecular Weight | 208.25500 | |
| Density | 1.157g/cm3 | Boiling Point | 373.8ºC at 760 mmHg | |
| Molecular Formula | C15H12O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.1ºC | |
| Name | 1-(9H-fluoren-3-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.157g/cm3 |
|---|---|
| Boiling Point | 373.8ºC at 760 mmHg |
| Molecular Formula | C15H12O |
| Molecular Weight | 208.25500 |
| Flash Point | 165.1ºC |
| Exact Mass | 208.08900 |
| PSA | 17.07000 |
| LogP | 3.46040 |
| Index of Refraction | 1.627 |
| InChIKey | CSABYBOSPVTETQ-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc2c(c1)-c1ccccc1C2 |
| HS Code | 2914399090 |
|---|
|
~72%
1-(9H-FLUOREN-3... CAS#:55718-48-4 |
| Literature: Hwang, Seung Jun; Kim, Hyun Jin; Chang, Sukbok Organic Letters, 2009 , vol. 11, # 20 p. 4588 - 4591 |
|
~%
1-(9H-FLUOREN-3... CAS#:55718-48-4 |
| Literature: Cairns,J.F.; Hickinbottom,W.J. Journal of the Chemical Society, 1962 , p. 867 - 870 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914399090 |
|---|---|
| Summary | 2914399090. other aromatic ketones without other oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 3-acetylfluorene |
| acetylfluorene |
| 1-(9H-fluoren-2-yl)ethanone |
| 3-acetyl-9H-fluorene |
| 3-Acetyl-fluoren |
| 1-(9H-Fluoren-3-yl)-ethanone |