5-O-Trityl-2,3-O-isopropylidene-D-ribofuranose structure
|
Common Name | 5-O-Trityl-2,3-O-isopropylidene-D-ribofuranose | ||
|---|---|---|---|---|
| CAS Number | 55726-19-7 | Molecular Weight | 432.50800 | |
| Density | 1.191 g/cm3 | Boiling Point | 565.271ºC at 760 mmHg | |
| Molecular Formula | C27H28O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (3aR,6R,6aR)-2,2-dimethyl-6-(trityloxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.191 g/cm3 |
|---|---|
| Boiling Point | 565.271ºC at 760 mmHg |
| Molecular Formula | C27H28O5 |
| Molecular Weight | 432.50800 |
| Exact Mass | 432.19400 |
| PSA | 57.15000 |
| LogP | 4.23240 |
| Index of Refraction | 1.579 |
| InChIKey | NRCVVYSZYAHOMW-AWYPOSSQSA-N |
| SMILES | CC1(C)OC2C(O)OC(COC(c3ccccc3)(c3ccccc3)c3ccccc3)C2O1 |
| HS Code | 2932190090 |
|---|
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 5-O-Trityl-2,3-O-isopropylidene-D-ribofuranose |
| 2,3-O-Isopropylidene-5-O-trityl-D-ribofuranose |
| (3aR,6R,6aR)-2,2-dimethyl-6-((trityloxy)methyl)tetrahydrofuro[3,4-d][1,3]dioxol-4-ol |
| 2,3-O-Isopropyliden-5-O-trityl-D-ribose |