7-Methyl-6-thioguanosine structure
|
Common Name | 7-Methyl-6-thioguanosine | ||
|---|---|---|---|---|
| CAS Number | 55727-10-1 | Molecular Weight | 313.333 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H15N5O4S | Melting Point | >175ºC (dec.) | |
| MSDS | N/A | Flash Point | N/A | |
Use of 7-Methyl-6-thioguanosineMESG is a chromophoric substrate which can be used for the quantitation of inorganic phosphate. |
| Name | 7-Methyl-6-thioguanosine |
|---|---|
| Synonym | More Synonyms |
| Description | MESG is a chromophoric substrate which can be used for the quantitation of inorganic phosphate. |
|---|---|
| Related Catalog | |
| References |
| Melting Point | >175ºC (dec.) |
|---|---|
| Molecular Formula | C11H15N5O4S |
| Molecular Weight | 313.333 |
| Exact Mass | 313.084473 |
| PSA | 130.53000 |
| InChIKey | JZOJDNSUWURGIR-KQYNXXCUSA-N |
| SMILES | Cn1c[n+](C2OC(CO)C(O)C2[O-])c2[nH]c(N)nc(=S)c21 |
| Storage condition | -20°C |
| 7H-Purinium, 2-amino-6-mercapto-7-methyl-9-β-D-ribofuranosyl-, inner salt |
| 2-Amino-7-methyl-9-(β-D-ribofuranosyl)-7H-purin-9-ium-6-thiolate |
| 7-methyl-6-thioguanosine |
| MESG |