ethyl 2-[(3-methyl-2-phenylmethoxycarbonylamino-butanoyl)amino]propanoate structure
|
Common Name | ethyl 2-[(3-methyl-2-phenylmethoxycarbonylamino-butanoyl)amino]propanoate | ||
|---|---|---|---|---|
| CAS Number | 55739-16-7 | Molecular Weight | 350.40900 | |
| Density | 1.129g/cm3 | Boiling Point | 520.8ºC at 760 mmHg | |
| Molecular Formula | C18H26N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 268.8ºC | |
| Name | ethyl 2-[[3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.129g/cm3 |
|---|---|
| Boiling Point | 520.8ºC at 760 mmHg |
| Molecular Formula | C18H26N2O5 |
| Molecular Weight | 350.40900 |
| Flash Point | 268.8ºC |
| Exact Mass | 350.18400 |
| PSA | 93.73000 |
| LogP | 2.78700 |
| Index of Refraction | 1.51 |
| InChIKey | ATQKPMIWKRREAT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)NC(=O)C(NC(=O)OCc1ccccc1)C(C)C |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzyloxycarbonyl-L-valyl-L-alanin-ethylester |
| Z-L-Val-L-Ala-OEt |
| Z-Val-Ala-OEt |
| Z-Val-Ala-OC2H5 |