5-Nitro-1H-indole-3-ethanamine structure
|
Common Name | 5-Nitro-1H-indole-3-ethanamine | ||
|---|---|---|---|---|
| CAS Number | 55747-72-3 | Molecular Weight | 205.213 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 434.3±30.0 °C at 760 mmHg | |
| Molecular Formula | C10H11N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.4±24.6 °C | |
| Name | 2-(5-nitro-1H-indol-3-yl)ethanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 434.3±30.0 °C at 760 mmHg |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.213 |
| Flash Point | 216.4±24.6 °C |
| Exact Mass | 205.085129 |
| PSA | 87.63000 |
| LogP | 1.77 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.702 |
| InChIKey | GPZRBKWRRKBOAC-UHFFFAOYSA-N |
| SMILES | NCCc1c[nH]c2ccc([N+](=O)[O-])cc12 |
|
~%
5-Nitro-1H-indo... CAS#:55747-72-3 |
| Literature: Journal of the American Chemical Society, , vol. 75, p. 1877,1880 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 2-(5-Nitro-1H-indol-3-yl)ethanamine |
| 5-Nitro-tryptamine |
| 1H-Indole-3-ethanamine, 5-nitro- |
| 5-Nitro-1H-indole-3-ethanamine |