2-(2-methylhydrazinyl)quinoline-4-carboxylic acid structure
|
Common Name | 2-(2-methylhydrazinyl)quinoline-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 55764-53-9 | Molecular Weight | 217.22400 | |
| Density | 1.378g/cm3 | Boiling Point | 286.4ºC at 760 mmHg | |
| Molecular Formula | C11H11N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 127ºC | |
| Name | 2-(2-methylhydrazinyl)quinoline-4-carboxylic acid |
|---|
| Density | 1.378g/cm3 |
|---|---|
| Boiling Point | 286.4ºC at 760 mmHg |
| Molecular Formula | C11H11N3O2 |
| Molecular Weight | 217.22400 |
| Flash Point | 127ºC |
| Exact Mass | 217.08500 |
| PSA | 74.25000 |
| LogP | 1.94320 |
| Index of Refraction | 1.721 |
| InChIKey | XLJAIFHRTIZFNC-UHFFFAOYSA-N |
| SMILES | CNNc1cc(C(=O)O)c2ccccc2n1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |