Arprinocid structure
|
Common Name | Arprinocid | ||
|---|---|---|---|---|
| CAS Number | 55779-18-5 | Molecular Weight | 277.68 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 504.6±60.0 °C at 760 mmHg | |
| Molecular Formula | C12H9ClFN5 | Melting Point | 441ºC | |
| MSDS | N/A | Flash Point | 259.0±32.9 °C | |
Use of ArprinocidArprinocid is a purine analog with activity against murine Toxoplasma gondii[1]. |
| Name | 9-(2-Chloro-6-fluorobenzyl)-9H-purin-6-amine |
|---|---|
| Synonym | More Synonyms |
| Description | Arprinocid is a purine analog with activity against murine Toxoplasma gondii[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 504.6±60.0 °C at 760 mmHg |
| Melting Point | 441ºC |
| Molecular Formula | C12H9ClFN5 |
| Molecular Weight | 277.68 |
| Flash Point | 259.0±32.9 °C |
| Exact Mass | 277.053040 |
| PSA | 69.62000 |
| LogP | 1.73 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.732 |
| InChIKey | NAPNOSFRRMHNBJ-UHFFFAOYSA-N |
| SMILES | Nc1ncnc2c1ncn2Cc1c(F)cccc1Cl |
| 9-[(2-chloro-6-fluorophenyl)methyl]purin-6-amine |
| MFCD00867210 |
| 9-(2-Chloro-6-fluorobenzyl)-9H-purin-6-amine |
| EINECS 259-817-8 |
| 9H-purin-6-amine, 9-[(2-chloro-6-fluorophenyl)methyl]- |
| Arprinocid |