Tristenonol aglycone
Tristenonol aglycone structure
|
Common Name | Tristenonol aglycone | ||
|---|---|---|---|---|
| CAS Number | 557792-97-9 | Molecular Weight | 320.25100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H12O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Tristenonol aglycone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H12O8 |
|---|---|
| Molecular Weight | 320.25100 |
| Exact Mass | 320.05300 |
| PSA | 147.68000 |
| LogP | 0.89190 |
| InChIKey | KJXSIXMJHKAJOD-UHFFFAOYSA-N |
| SMILES | O=C1c2c(O)cc(O)cc2OC(c2cc(O)c(O)c(O)c2)C1O |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:529-44-2This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| dihydromyricetin |
| 3,5,7-trihydroxy-2-(3,4,5-trihydroxy-phenyl)-chroman-4-one |
| (+/-)-dihydromyricetin |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does Tristenonol aglycone have? |
| A: English synonyms of Tristenonol aglycone: dihydromyricetin, 3,5,7-trihydroxy-2-(3,4,5-trihydroxy-phenyl)-chroman-4-one, (+/-)-dihydromyricetin. |
| Q: What is the CAS number of Tristenonol aglycone? |
| A: CAS number of Tristenonol aglycone is 557792-97-9. |
| Q: What is the SMILES notation of Tristenonol aglycone? |
| A: SMILES notation of Tristenonol aglycone is O=C1c2c(O)cc(O)cc2OC(c2cc(O)c(O)c(O)c2)C1O. |
| Q: What is the English name of Tristenonol aglycone? |
| A: The English name of Tristenonol aglycone is Tristenonol aglycone. |
| Q: What is the molecular formula of Tristenonol aglycone? |
| A: Molecular formula of Tristenonol aglycone is C15H12O8. |
| Q: What is the Chinese name of 557792-97-9? |
| A: Chinese name of 557792-97-9 is 557792-97-9. |
| Q: What is the LogP of Tristenonol aglycone? |
| A: LogP of Tristenonol aglycone is 0.89190. |
| Q: What is the molecular weight of Tristenonol aglycone? |
| A: Molecular weight of Tristenonol aglycone is 320.25100. |
| Q: What is the InChIKey of Tristenonol aglycone? |
| A: InChIKey of Tristenonol aglycone is KJXSIXMJHKAJOD-UHFFFAOYSA-N. |
| Q: What are the downstream products of Tristenonol aglycone? |
| A: Related downstream products(CAS) of Tristenonol aglycone: 529-44-2. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |