AKOS BBS-00001946 structure
|
Common Name | AKOS BBS-00001946 | ||
|---|---|---|---|---|
| CAS Number | 55784-68-4 | Molecular Weight | 195.25800 | |
| Density | 1.161g/cm3 | Boiling Point | 343.4ºC at 760 mmHg | |
| Molecular Formula | C11H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161.5ºC | |
| Name | 1,7,7-trimethyl-2-oxobicyclo[2.2.1]heptane-4-carboxamide |
|---|
| Density | 1.161g/cm3 |
|---|---|
| Boiling Point | 343.4ºC at 760 mmHg |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.25800 |
| Flash Point | 161.5ºC |
| Exact Mass | 195.12600 |
| PSA | 60.16000 |
| LogP | 1.95750 |
| Index of Refraction | 1.536 |
| InChIKey | WUMGBNKQVYHUFP-UHFFFAOYSA-N |
| SMILES | CC12CCC(C(N)=O)(CC1=O)C2(C)C |
| HS Code | 2924299090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |