N,N-diethyl-N-methyl-N-(methylsulfonyl)ammonium fluorosulfate structure
|
Common Name | N,N-diethyl-N-methyl-N-(methylsulfonyl)ammonium fluorosulfate | ||
|---|---|---|---|---|
| CAS Number | 55791-04-3 | Molecular Weight | 265.32300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H16FNO5S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N,N-diethyl-N-methyl-N-(methylsulfonyl)ammonium fluorosulfate |
|---|
| Molecular Formula | C6H16FNO5S2 |
|---|---|
| Molecular Weight | 265.32300 |
| Exact Mass | 265.04500 |
| PSA | 108.10000 |
| LogP | 2.01010 |
| InChIKey | VERIHBXWNIYGAA-UHFFFAOYSA-M |
| SMILES | CC[N+](C)(CC)S(C)(=O)=O.O=S(=O)([O-])F |
|
~%
N,N-diethyl-N-m... CAS#:55791-04-3 |
| Literature: King,J.F.; du Manoir,J.R. Journal of the American Chemical Society, 1975 , vol. 97, p. 2566 - 2567 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |