nonadecafluoro-9-iodononane
Modify Date: 2025-09-18 18:29:40
nonadecafluoro-9-iodononane structure
|
Common Name | nonadecafluoro-9-iodononane | ||
|---|---|---|---|---|
| CAS Number | 558-97-4 | Molecular Weight | 595.97000 | |
| Density | 1.987g/cm3 | Boiling Point | 180.6ºC at 760mmHg | |
| Molecular Formula | C9F19I | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 79.7ºC | |
| Name | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-nonadecafluoro-9-iodononane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.987g/cm3 |
|---|---|
| Boiling Point | 180.6ºC at 760mmHg |
| Molecular Formula | C9F19I |
| Molecular Weight | 595.97000 |
| Flash Point | 79.7ºC |
| Exact Mass | 595.87400 |
| LogP | 7.02360 |
| Index of Refraction | 1.32 |
| InChIKey | YYCFEDCTRHSPLB-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)I |
| HS Code | 2903799090 |
|---|
|
~%
nonadecafluoro-... CAS#:558-97-4 |
| Literature: Haszeldine Journal of the Chemical Society, 1953 , p. 3761,3766 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:375-96-2| HS Code | 2903799090 |
|---|---|
| Summary | 2903799090 halogenated derivatives of acyclic hydrocarbons containing two or more different halogens。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| nonadecafluoro-9-iodononane |
| EINECS 209-199-0 |
| Nonadecafluor-1-jod-nonan |
| nonadecafluoro-1-iodo-nonane |