2,4(1H,3H)-Pyrimidinedione, 5-bromo-1-(tetrahydro-2H-pyran-2-yl)- structure
|
Common Name | 2,4(1H,3H)-Pyrimidinedione, 5-bromo-1-(tetrahydro-2H-pyran-2-yl)- | ||
|---|---|---|---|---|
| CAS Number | 5580-89-2 | Molecular Weight | 275.09900 | |
| Density | 1.684g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H11BrN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-bromo-1-(oxan-2-yl)pyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.684g/cm3 |
|---|---|
| Molecular Formula | C9H11BrN2O3 |
| Molecular Weight | 275.09900 |
| Exact Mass | 273.99500 |
| PSA | 64.09000 |
| LogP | 0.99820 |
| Index of Refraction | 1.597 |
| InChIKey | YKSYKEJFDYVOEW-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c(=O)n(C2CCCCO2)cc1Br |
|
~%
2,4(1H,3H)-Pyri... CAS#:5580-89-2 |
| Literature: Bakker, Cees N. M.; Kaspersen, Frans M. Recueil: Journal of the Royal Netherlands Chemical Society, 1981 , vol. 100, # 7/8 p. 267 - 271 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 5-bromo-1-tetrahydropyran-2-yl-1H-pyrimidine-2,4-dione |