ethyl 7-(dimethylamino)-2-oxo-2H-benzopyran-3-carboxylate
ethyl 7-(dimethylamino)-2-oxo-2H-benzopyran-3-carboxylate structure
|
Common Name | ethyl 7-(dimethylamino)-2-oxo-2H-benzopyran-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 55804-64-3 | Molecular Weight | 261.27300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 7-(dimethylamino)-2-oxo-2H-benzopyran-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H15NO4 |
|---|---|
| Molecular Weight | 261.27300 |
| Exact Mass | 261.10000 |
| PSA | 59.75000 |
| LogP | 2.03570 |
| InChIKey | AYCOCJMEYVYNPM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc2ccc(N(C)C)cc2oc1=O |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:122607-15-2This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| ethyl 7-dimethylaminocoumarin-3-carboxylate |
| ethyl 7-dimethylamino-2-oxo-2H-chromene-3-carboxylate |
| Ethyl 7-(dimethylamino)-2-oxo-2H-1-benzopyran-3-carboxylate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of ethyl 7-(dimethylamino)-2-oxo-2H-benzopyran-3-carboxylate? |
| A: Molecular formula of ethyl 7-(dimethylamino)-2-oxo-2H-benzopyran-3-carboxylate is C14H15NO4. |
| Q: What English synonyms does ethyl 7-(dimethylamino)-2-oxo-2H-benzopyran-3-carboxylate have? |
| A: English synonyms of ethyl 7-(dimethylamino)-2-oxo-2H-benzopyran-3-carboxylate: ethyl 7-dimethylaminocoumarin-3-carboxylate, ethyl 7-dimethylamino-2-oxo-2H-chromene-3-carboxylate, Ethyl 7-(dimethylamino)-2-oxo-2H-1-benzopyran-3-carboxylate. |
| Q: What is the molecular weight of ethyl 7-(dimethylamino)-2-oxo-2H-benzopyran-3-carboxylate? |
| A: Molecular weight of ethyl 7-(dimethylamino)-2-oxo-2H-benzopyran-3-carboxylate is 261.27300. |
| Q: What is the LogP of ethyl 7-(dimethylamino)-2-oxo-2H-benzopyran-3-carboxylate? |
| A: LogP of ethyl 7-(dimethylamino)-2-oxo-2H-benzopyran-3-carboxylate is 2.03570. |
| Q: What is the InChIKey of ethyl 7-(dimethylamino)-2-oxo-2H-benzopyran-3-carboxylate? |
| A: InChIKey of ethyl 7-(dimethylamino)-2-oxo-2H-benzopyran-3-carboxylate is AYCOCJMEYVYNPM-UHFFFAOYSA-N. |
| Q: What is the CAS number of ethyl 7-(dimethylamino)-2-oxo-2H-benzopyran-3-carboxylate? |
| A: CAS number of ethyl 7-(dimethylamino)-2-oxo-2H-benzopyran-3-carboxylate is 55804-64-3. |
| Q: What is the English name of ethyl 7-(dimethylamino)-2-oxo-2H-benzopyran-3-carboxylate? |
| A: The English name of ethyl 7-(dimethylamino)-2-oxo-2H-benzopyran-3-carboxylate is ethyl 7-(dimethylamino)-2-oxo-2H-benzopyran-3-carboxylate. |
| Q: What are the downstream products of ethyl 7-(dimethylamino)-2-oxo-2H-benzopyran-3-carboxylate? |
| A: Related downstream products(CAS) of ethyl 7-(dimethylamino)-2-oxo-2H-benzopyran-3-carboxylate: 122607-15-2. |
| Q: What is the polar surface area (PSA) of ethyl 7-(dimethylamino)-2-oxo-2H-benzopyran-3-carboxylate? |
| A: Polar surface area (PSA) of ethyl 7-(dimethylamino)-2-oxo-2H-benzopyran-3-carboxylate is 59.75000. |
| Q: What is the SMILES notation of ethyl 7-(dimethylamino)-2-oxo-2H-benzopyran-3-carboxylate? |
| A: SMILES notation of ethyl 7-(dimethylamino)-2-oxo-2H-benzopyran-3-carboxylate is CCOC(=O)c1cc2ccc(N(C)C)cc2oc1=O. |