[(4-chlorophenyl)-phenyl-methylidene]hydrazine structure
|
Common Name | [(4-chlorophenyl)-phenyl-methylidene]hydrazine | ||
|---|---|---|---|---|
| CAS Number | 55816-27-8 | Molecular Weight | 230.69300 | |
| Density | 1.17g/cm3 | Boiling Point | 353.8ºC at 760 mmHg | |
| Molecular Formula | C13H11ClN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.8ºC | |
| Name | [(4-chlorophenyl)-phenylmethylidene]hydrazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 353.8ºC at 760 mmHg |
| Molecular Formula | C13H11ClN2 |
| Molecular Weight | 230.69300 |
| Flash Point | 167.8ºC |
| Exact Mass | 230.06100 |
| PSA | 38.38000 |
| LogP | 3.75140 |
| Index of Refraction | 1.599 |
| InChIKey | UAPAHLNYPGDDBX-DTQAZKPQSA-N |
| SMILES | NN=C(c1ccccc1)c1ccc(Cl)cc1 |
|
~82%
[(4-chloropheny... CAS#:55816-27-8 |
| Literature: Al-Kahraman, Yasser M.S.A.; Yasinzai, Masoom; Singh, Girija S. Archives of Pharmacal Research, 2012 , vol. 35, # 6 p. 1009 - 1013 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 2-benzoyl-5-chloro-benzoic acid |
| 4-chloro-benzophenone-hydrazone |
| 4-Chlor-benzophenon-hydrazon |
| BENZOIC ACID,2-BENZOYL-5-CHLORO |
| 2-CARBOXY-4-CHLOROBENZOPHENONE |
| 2-Benzoyl-5-chlor-benzoesaeure |
| 4-Chlorobenzophenone-2-carboxylic acid |