1H-Pyrrole-3-carbonitrile,2-amino-1,4,5-triphenyl- structure
|
Common Name | 1H-Pyrrole-3-carbonitrile,2-amino-1,4,5-triphenyl- | ||
|---|---|---|---|---|
| CAS Number | 55817-66-8 | Molecular Weight | 335.40100 | |
| Density | 1.14g/cm3 | Boiling Point | 562ºC at 760mmHg | |
| Molecular Formula | C23H17N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 293.7ºC | |
| Name | 2-amino-1,4,5-triphenylpyrrole-3-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 562ºC at 760mmHg |
| Molecular Formula | C23H17N3 |
| Molecular Weight | 335.40100 |
| Flash Point | 293.7ºC |
| Exact Mass | 335.14200 |
| PSA | 54.74000 |
| LogP | 5.84638 |
| Index of Refraction | 1.644 |
| InChIKey | OWSPYYIAKHSPQA-UHFFFAOYSA-N |
| SMILES | N#Cc1c(-c2ccccc2)c(-c2ccccc2)n(-c2ccccc2)c1N |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-AMINO-1,4,5-TRIPHENYL-PYRROLE-3-CARBONITRILE |
| 1H-Pyrrole-3-carbonitrile,2-amino-1,4,5-triphenyl |
| 2-Amino-1,4,5-triphenyl-3-cyano-pyrrol |