N-(2,4,6-trimethylphenyl)sulfonyladamantane-1-carboxamide structure
|
Common Name | N-(2,4,6-trimethylphenyl)sulfonyladamantane-1-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 5582-59-2 | Molecular Weight | 361.49800 | |
| Density | 1.234g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C20H27NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(2,4,6-trimethylphenyl)sulfonyladamantane-1-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.234g/cm3 |
|---|---|
| Molecular Formula | C20H27NO3S |
| Molecular Weight | 361.49800 |
| Exact Mass | 361.17100 |
| PSA | 75.11000 |
| LogP | 5.55420 |
| Index of Refraction | 1.583 |
| InChIKey | LPYHSGJHFKVMAD-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(S(=O)(=O)NC(=O)C23CC4CC(CC(C4)C2)C3)c(C)c1 |
|
~%
N-(2,4,6-trimet... CAS#:5582-59-2 |
| Literature: Abel,E.W.; Armitage,D.A. Journal of Organometallic Chemistry, 1966 , vol. 5, p. 326 - 329 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Tetraphenylcyclotetraarsthian |
| 2,4,6,8-tetraphenyl-1,3,5,7,2,4,6,8-tetrathiatetrarsocane |