3-Chloro-N-[(phenylmethoxy)carbonyl]-L-alanine phenylmethyl ester structure
|
Common Name | 3-Chloro-N-[(phenylmethoxy)carbonyl]-L-alanine phenylmethyl ester | ||
|---|---|---|---|---|
| CAS Number | 55822-82-7 | Molecular Weight | 347.79300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H18ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | benzyl (2R)-3-chloro-2-(phenylmethoxycarbonylamino)propanoate |
|---|
| Molecular Formula | C18H18ClNO4 |
|---|---|
| Molecular Weight | 347.79300 |
| Exact Mass | 347.09200 |
| PSA | 64.63000 |
| LogP | 3.65450 |
| InChIKey | JYSZSIWECWRSIF-INIZCTEOSA-N |
| SMILES | O=C(NC(CCl)C(=O)OCc1ccccc1)OCc1ccccc1 |
| HS Code | 2924299090 |
|---|
|
~%
3-Chloro-N-[(ph... CAS#:55822-82-7 |
| Literature: The Journal of organic chemistry, , vol. 41, # 22 p. 3634 - 3635 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |