1-(4-acetylphenyl)-2,2-dimethylpropan-1-one
1-(4-acetylphenyl)-2,2-dimethylpropan-1-one structure
|
Common Name | 1-(4-acetylphenyl)-2,2-dimethylpropan-1-one | ||
|---|---|---|---|---|
| CAS Number | 55866-13-2 | Molecular Weight | 204.26500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(4-acetylphenyl)-2,2-dimethylpropan-1-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H16O2 |
|---|---|
| Molecular Weight | 204.26500 |
| Exact Mass | 204.11500 |
| PSA | 34.14000 |
| LogP | 3.11800 |
| InChIKey | BEARUEAJMMARLM-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(C(=O)C(C)(C)C)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1-(4-acetylphen... CAS#:55866-13-2 |
| Literature: Sandoz, Inc. Patent: US3998850 A1, 1976 ; |
![2,2-dimethyl-1-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]propan-1-one structure](https://image.chemsrc.com/caspic/122/55866-12-1.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4'-acetylpivalophenone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1-(4-acetylphenyl)-2,2-dimethylpropan-1-one? |
| A: Molecular weight of 1-(4-acetylphenyl)-2,2-dimethylpropan-1-one is 204.26500. |
| Q: What is the SMILES notation of 1-(4-acetylphenyl)-2,2-dimethylpropan-1-one? |
| A: SMILES notation of 1-(4-acetylphenyl)-2,2-dimethylpropan-1-one is CC(=O)c1ccc(C(=O)C(C)(C)C)cc1. |
| Q: What is the molecular formula of 1-(4-acetylphenyl)-2,2-dimethylpropan-1-one? |
| A: Molecular formula of 1-(4-acetylphenyl)-2,2-dimethylpropan-1-one is C13H16O2. |
| Q: What is the CAS number of 1-(4-acetylphenyl)-2,2-dimethylpropan-1-one? |
| A: CAS number of 1-(4-acetylphenyl)-2,2-dimethylpropan-1-one is 55866-13-2. |
| Q: What is the English name of 1-(4-acetylphenyl)-2,2-dimethylpropan-1-one? |
| A: The English name of 1-(4-acetylphenyl)-2,2-dimethylpropan-1-one is 1-(4-acetylphenyl)-2,2-dimethylpropan-1-one. |
| Q: What is the polar surface area (PSA) of 1-(4-acetylphenyl)-2,2-dimethylpropan-1-one? |
| A: Polar surface area (PSA) of 1-(4-acetylphenyl)-2,2-dimethylpropan-1-one is 34.14000. |
| Q: What English synonyms does 1-(4-acetylphenyl)-2,2-dimethylpropan-1-one have? |
| A: English synonyms of 1-(4-acetylphenyl)-2,2-dimethylpropan-1-one: 4'-acetylpivalophenone. |
| Q: What is the Chinese name of 55866-13-2? |
| A: Chinese name of 55866-13-2 is 55866-13-2. |
| Q: What is the InChIKey of 1-(4-acetylphenyl)-2,2-dimethylpropan-1-one? |
| A: InChIKey of 1-(4-acetylphenyl)-2,2-dimethylpropan-1-one is BEARUEAJMMARLM-UHFFFAOYSA-N. |
| Q: What are the upstream materials of 1-(4-acetylphenyl)-2,2-dimethylpropan-1-one? |
| A: Related upstream materials(CAS) of 1-(4-acetylphenyl)-2,2-dimethylpropan-1-one: 55866-12-1. |