Sumaresinolic acid structure
|
Common Name | Sumaresinolic acid | ||
|---|---|---|---|---|
| CAS Number | 559-64-8 | Molecular Weight | 472.70000 | |
| Density | 1.14g/cm3 | Boiling Point | 585ºC at 760mmHg | |
| Molecular Formula | C30H48O4 | Melting Point | 285-289ºC | |
| MSDS | N/A | Flash Point | 321.6ºC | |
| Name | (4aS,6aR,6aS,6bR,8R,8aR,10S,12aR,14bS)-8,10-dihydroxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 585ºC at 760mmHg |
| Melting Point | 285-289ºC |
| Molecular Formula | C30H48O4 |
| Molecular Weight | 472.70000 |
| Flash Point | 321.6ºC |
| Exact Mass | 472.35500 |
| PSA | 77.76000 |
| LogP | 6.20440 |
| Index of Refraction | 1.568 |
| InChIKey | KLHSKTMVSOWVLD-PCPVNUTRSA-N |
| SMILES | CC1(C)CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(C)C5C(O)CC43C)C2C1 |
|
Name: Induction of quinone reductase
Source: ChEMBL
Target: NAD(P)H dehydrogenase [quinone] 1
External Id: CHEMBL1004305
|
|
Name: ERK5 transcriptional activity HTS
Source: 24565
Target: N/A
External Id: ERK5 transcriptional activity-HTS
|
|
Name: Growth inhibition of human HL60 cells after 3 days by trypan blue method
Source: ChEMBL
Target: HL-60
External Id: CHEMBL978289
|
|
Name: Induction of cell differentiation of human HL60 cells after 3 days by NBT reduction m...
Source: ChEMBL
Target: HL-60
External Id: CHEMBL978290
|
| Sumaresinolsaeure |
| UNII-ZLX0T88D9C |
| 6beta-hydroxy-oleanolic acid |
| Sumaresinolic acid |
| Sumaresinol |