2,2,3,3,4,4,4-heptafluoro-1-(4-methylphenyl)butan-1-one structure
|
Common Name | 2,2,3,3,4,4,4-heptafluoro-1-(4-methylphenyl)butan-1-one | ||
|---|---|---|---|---|
| CAS Number | 559-92-2 | Molecular Weight | 288.16200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H7F7O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2,3,3,4,4,4-heptafluoro-1-(4-methylphenyl)butan-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H7F7O |
|---|---|
| Molecular Weight | 288.16200 |
| Exact Mass | 288.03900 |
| PSA | 17.07000 |
| LogP | 4.01060 |
| InChIKey | LAXSGZOZXFTLFG-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| HS Code | 2914700090 |
|---|
|
~%
2,2,3,3,4,4,4-h... CAS#:559-92-2 |
| Literature: Simons et al. Journal of the American Chemical Society, 1953 , vol. 75, p. 5621 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| heptafluoro-1-p-tolyl-butan-1-one |
| Heptafluor-1-p-tolyl-butan-1-on |