2-Nonene-4,6-dione,7,7,8,8,9,9,9-heptafluoro-2-methyl- structure
|
Common Name | 2-Nonene-4,6-dione,7,7,8,8,9,9,9-heptafluoro-2-methyl- | ||
|---|---|---|---|---|
| CAS Number | 559-99-9 | Molecular Weight | 294.16600 | |
| Density | 1.339g/cm3 | Boiling Point | 217.3ºC at 760mmHg | |
| Molecular Formula | C10H9F7O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 81.6ºC | |
| Name | 7,7,8,8,9,9,9-heptafluoro-2-methylnon-2-ene-4,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.339g/cm3 |
|---|---|
| Boiling Point | 217.3ºC at 760mmHg |
| Molecular Formula | C10H9F7O2 |
| Molecular Weight | 294.16600 |
| Flash Point | 81.6ºC |
| Exact Mass | 294.04900 |
| PSA | 34.14000 |
| LogP | 3.31380 |
| Index of Refraction | 1.367 |
| InChIKey | NOQZTHSTUPFMOL-UHFFFAOYSA-N |
| SMILES | CC(C)=CC(=O)CC(=O)C(F)(F)C(F)(F)C(F)(F)F |
|
~%
2-Nonene-4,6-di... CAS#:559-99-9 |
| Literature: Barkley; Levine Journal of the American Chemical Society, 1951 , vol. 73, p. 4625 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 7,7,8,8,9,9,9-Heptafluor-2-methyl-non-2-en-4,6-dion |
| 7,7,8,8,9,9,9-heptafluoro-2-methyl-non-2-ene-4,6-dione |