Isoorixine
Modify Date: 2025-08-20 20:06:43
Isoorixine structure
|
Common Name | Isoorixine | ||
|---|---|---|---|---|
| CAS Number | 55902-66-4 | Molecular Weight | 335.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H21NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Isoorixine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H21NO6 |
|---|---|
| Molecular Weight | 335.4 |
| InChIKey | DAWBKOMKNXDZAN-GFCCVEGCSA-N |
| SMILES | COc1c(CC(O)C(C)(C)O)c(=O)n(C)c2c3c(ccc12)OCO3 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Isoorixine? |
| A: Molecular weight of Isoorixine is 335.4. |
| Q: What is the SMILES notation of Isoorixine? |
| A: SMILES notation of Isoorixine is COc1c(CC(O)C(C)(C)O)c(=O)n(C)c2c3c(ccc12)OCO3. |
| Q: What is the CAS number of Isoorixine? |
| A: CAS number of Isoorixine is 55902-66-4. |
| Q: What is the molecular formula of Isoorixine? |
| A: Molecular formula of Isoorixine is C17H21NO6. |
| Q: What is the InChIKey of Isoorixine? |
| A: InChIKey of Isoorixine is DAWBKOMKNXDZAN-GFCCVEGCSA-N. |
| Q: What is the English name of Isoorixine? |
| A: The English name of Isoorixine is Isoorixine. |
| Q: What is the Chinese name of 55902-66-4? |
| A: Chinese name of 55902-66-4 is 55902-66-4. |