N-(cyclopentylcarbamoyl)-2-[4-(4-fluorophenyl)phthalazin-1-yl]sulfanylacetamide
Modify Date: 2025-12-31 06:46:11
![N-(cyclopentylcarbamoyl)-2-[4-(4-fluorophenyl)phthalazin-1-yl]sulfanylacetamide Structure](https://image.chemsrc.com/caspic/281/5591-90-2.png)
N-(cyclopentylcarbamoyl)-2-[4-(4-fluorophenyl)phthalazin-1-yl]sulfanylacetamide structure
|
Common Name | N-(cyclopentylcarbamoyl)-2-[4-(4-fluorophenyl)phthalazin-1-yl]sulfanylacetamide | ||
|---|---|---|---|---|
| CAS Number | 5591-90-2 | Molecular Weight | 424.49100 | |
| Density | 1.37g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C22H21FN4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(cyclopentylcarbamoyl)-2-[4-(4-fluorophenyl)phthalazin-1-yl]sulfanylacetamide |
|---|
| Density | 1.37g/cm3 |
|---|---|
| Molecular Formula | C22H21FN4O2S |
| Molecular Weight | 424.49100 |
| Exact Mass | 424.13700 |
| PSA | 116.26000 |
| LogP | 5.34110 |
| Index of Refraction | 1.669 |
| InChIKey | ZVPJXFGVGFLWDK-UHFFFAOYSA-N |
| SMILES | O=C(CSc1nnc(-c2ccc(F)cc2)c2ccccc12)NC(=O)NC1CCCC1 |
|
~%
N-(cyclopentylc... CAS#:5591-90-2 |
| Literature: Cossar,B.C.; Reynolds,D.D. Journal of Heterocyclic Chemistry, 1965 , vol. 2, p. 430 - 440 |
![1-chloro-3-[(3-chloro-2-hydroxypropyl)disulfanyl]propan-2-ol structure](https://image.chemsrc.com/caspic/019/5521-80-2.png)
| Precursor 2 | |
|---|---|
| DownStream 0 | |