N-(cyclopentylcarbamoyl)-2-[4-(4-fluorophenyl)phthalazin-1-yl]sulfanylacetamide
![N-(cyclopentylcarbamoyl)-2-[4-(4-fluorophenyl)phthalazin-1-yl]sulfanylacetamide Structure](https://image.chemsrc.com/caspic/281/5591-90-2.png)
N-(cyclopentylcarbamoyl)-2-[4-(4-fluorophenyl)phthalazin-1-yl]sulfanylacetamide structure
|
Common Name | N-(cyclopentylcarbamoyl)-2-[4-(4-fluorophenyl)phthalazin-1-yl]sulfanylacetamide | ||
|---|---|---|---|---|
| CAS Number | 5591-90-2 | Molecular Weight | 424.49100 | |
| Density | 1.37g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C22H21FN4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(cyclopentylcarbamoyl)-2-[4-(4-fluorophenyl)phthalazin-1-yl]sulfanylacetamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.37g/cm3 |
|---|---|
| Molecular Formula | C22H21FN4O2S |
| Molecular Weight | 424.49100 |
| Exact Mass | 424.13700 |
| PSA | 116.26000 |
| LogP | 5.34110 |
| Index of Refraction | 1.669 |
| InChIKey | ZVPJXFGVGFLWDK-UHFFFAOYSA-N |
| SMILES | O=C(CSc1nnc(-c2ccc(F)cc2)c2ccccc12)NC(=O)NC1CCCC1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
N-(cyclopentylc... CAS#:5591-90-2 |
| Literature: Cossar,B.C.; Reynolds,D.D. Journal of Heterocyclic Chemistry, 1965 , vol. 2, p. 430 - 440 |
![1-chloro-3-[(3-chloro-2-hydroxypropyl)disulfanyl]propan-2-ol structure](https://image.chemsrc.com/caspic/019/5521-80-2.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of N-(cyclopentylcarbamoyl)-2-[4-(4-fluorophenyl)phthalazin-1-yl]sulfanylacetamide? |
| A: LogP of N-(cyclopentylcarbamoyl)-2-[4-(4-fluorophenyl)phthalazin-1-yl]sulfanylacetamide is 5.34110. |
| Q: What is the molecular formula of N-(cyclopentylcarbamoyl)-2-[4-(4-fluorophenyl)phthalazin-1-yl]sulfanylacetamide? |
| A: Molecular formula of N-(cyclopentylcarbamoyl)-2-[4-(4-fluorophenyl)phthalazin-1-yl]sulfanylacetamide is C22H21FN4O2S. |
| Q: What is the SMILES notation of N-(cyclopentylcarbamoyl)-2-[4-(4-fluorophenyl)phthalazin-1-yl]sulfanylacetamide? |
| A: SMILES notation of N-(cyclopentylcarbamoyl)-2-[4-(4-fluorophenyl)phthalazin-1-yl]sulfanylacetamide is O=C(CSc1nnc(-c2ccc(F)cc2)c2ccccc12)NC(=O)NC1CCCC1. |
| Q: What is the InChIKey of N-(cyclopentylcarbamoyl)-2-[4-(4-fluorophenyl)phthalazin-1-yl]sulfanylacetamide? |
| A: InChIKey of N-(cyclopentylcarbamoyl)-2-[4-(4-fluorophenyl)phthalazin-1-yl]sulfanylacetamide is ZVPJXFGVGFLWDK-UHFFFAOYSA-N. |
| Q: What is the CAS number of N-(cyclopentylcarbamoyl)-2-[4-(4-fluorophenyl)phthalazin-1-yl]sulfanylacetamide? |
| A: CAS number of N-(cyclopentylcarbamoyl)-2-[4-(4-fluorophenyl)phthalazin-1-yl]sulfanylacetamide is 5591-90-2. |
| Q: What is the molecular weight of N-(cyclopentylcarbamoyl)-2-[4-(4-fluorophenyl)phthalazin-1-yl]sulfanylacetamide? |
| A: Molecular weight of N-(cyclopentylcarbamoyl)-2-[4-(4-fluorophenyl)phthalazin-1-yl]sulfanylacetamide is 424.49100. |
| Q: What is the English name of N-(cyclopentylcarbamoyl)-2-[4-(4-fluorophenyl)phthalazin-1-yl]sulfanylacetamide? |
| A: The English name of N-(cyclopentylcarbamoyl)-2-[4-(4-fluorophenyl)phthalazin-1-yl]sulfanylacetamide is N-(cyclopentylcarbamoyl)-2-[4-(4-fluorophenyl)phthalazin-1-yl]sulfanylacetamide. |
| Q: What are the upstream materials of N-(cyclopentylcarbamoyl)-2-[4-(4-fluorophenyl)phthalazin-1-yl]sulfanylacetamide? |
| A: Related upstream materials(CAS) of N-(cyclopentylcarbamoyl)-2-[4-(4-fluorophenyl)phthalazin-1-yl]sulfanylacetamide: 18811-62-6;5521-80-2. |
| Q: What is the polar surface area (PSA) of N-(cyclopentylcarbamoyl)-2-[4-(4-fluorophenyl)phthalazin-1-yl]sulfanylacetamide? |
| A: Polar surface area (PSA) of N-(cyclopentylcarbamoyl)-2-[4-(4-fluorophenyl)phthalazin-1-yl]sulfanylacetamide is 116.26000. |
| Q: What is the Chinese name of 5591-90-2? |
| A: Chinese name of 5591-90-2 is 5591-90-2. |