dimethyl benzene-1,4-dicarboxylate,ethane-1,2-diol,2-methyl-2-oxo-1,2λ5-oxaphospholan-5-one structure
|
Common Name | dimethyl benzene-1,4-dicarboxylate,ethane-1,2-diol,2-methyl-2-oxo-1,2λ5-oxaphospholan-5-one | ||
|---|---|---|---|---|
| CAS Number | 55918-56-4 | Molecular Weight | 390.32200 | |
| Density | N/A | Boiling Point | 285ºC at 760mmHg | |
| Molecular Formula | C16H23O9P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 148ºC | |
| Name | dimethyl benzene-1,4-dicarboxylate,ethane-1,2-diol,2-methyl-2-oxo-1,2λ5-oxaphospholan-5-one |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 285ºC at 760mmHg |
|---|---|
| Molecular Formula | C16H23O9P |
| Molecular Weight | 390.32200 |
| Flash Point | 148ºC |
| Exact Mass | 390.10800 |
| PSA | 146.24000 |
| LogP | 1.07200 |
| InChIKey | DWTJXBCQECRTNX-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(C(=O)OC)cc1.CP1(=O)CCC(=O)O1.OCCO |
| 1,4-Benzenedicarboxylic acid,1,4-dimethyl ester,polymer with 1,2-ethanediol and 2-methyl-1,2-oxaphospholan-5-one 2-oxide |
| 1,4-Benzenedicarboxylic acid,dimethyl ester,polymer with 1,2-ethanediol and 2-methyl-1,2-oxaphospholan-5-one 2-oxide |
| 2-methyl-2-oxo-1,2 |