N-(6-chloro-2-methoxyacridin-9-yl)-N',N'-dimethylpropane-1,3-diamine structure
|
Common Name | N-(6-chloro-2-methoxyacridin-9-yl)-N',N'-dimethylpropane-1,3-diamine | ||
|---|---|---|---|---|
| CAS Number | 55935-12-1 | Molecular Weight | 343.85000 | |
| Density | 1.229g/cm3 | Boiling Point | 519ºC at 760 mmHg | |
| Molecular Formula | C19H22ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 267.7ºC | |
| Name | N-(6-chloro-2-methoxyacridin-9-yl)-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.229g/cm3 |
|---|---|
| Boiling Point | 519ºC at 760 mmHg |
| Molecular Formula | C19H22ClN3O |
| Molecular Weight | 343.85000 |
| Flash Point | 267.7ºC |
| Exact Mass | 343.14500 |
| PSA | 40.62000 |
| LogP | 3.83550 |
| Index of Refraction | 1.662 |
| InChIKey | WBFCDJTXHXSTJK-UHFFFAOYSA-N |
| SMILES | COc1ccc2nc3cc(Cl)ccc3c(NCCCN(C)C)c2c1 |
| HS Code | 2933990090 |
|---|
|
~64%
N-(6-chloro-2-m... CAS#:55935-12-1 |
| Literature: Kitchen, S. E.; Wang, Yueh-Hwa; Baumstark, A. L.; Wilson, W. D.; Boykin, D. W. Journal of Medicinal Chemistry, 1985 , vol. 28, # 7 p. 940 - 944 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Acridine monomer |