19-methyl-1,4-diphenyl-1,4,4a,5a,6,11,11a,12a-octahydro-6,11-o-benzeno-1,4-epiazano-naphtho[2,3-g]isochromene-3,5,12-trione structure
|
Common Name | 19-methyl-1,4-diphenyl-1,4,4a,5a,6,11,11a,12a-octahydro-6,11-o-benzeno-1,4-epiazano-naphtho[2,3-g]isochromene-3,5,12-trione | ||
|---|---|---|---|---|
| CAS Number | 55975-65-0 | Molecular Weight | 537.60400 | |
| Density | 1.361g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C36H27NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 19-methyl-1,4-diphenyl-1,4,4a,5a,6,11,11a,12a-octahydro-6,11-o-benzeno-1,4-epiazano-naphtho[2,3-g]isochromene-3,5,12-trione |
|---|
| Density | 1.361g/cm3 |
|---|---|
| Molecular Formula | C36H27NO4 |
| Molecular Weight | 537.60400 |
| Exact Mass | 537.19400 |
| PSA | 63.68000 |
| LogP | 5.08260 |
| Index of Refraction | 1.691 |
| InChIKey | IUBAURKGIHZUSJ-UHFFFAOYSA-N |
| SMILES | CN1C2(c3ccccc3)OC(=O)C1(c1ccccc1)C1C(=O)C3C4c5ccccc5C(c5ccccc54)C3C(=O)C12 |
|
~%
19-methyl-1,4-d... CAS#:55975-65-0 |
| Literature: Myers,J.A. et al. Journal of Organic Chemistry, 1975 , vol. 40, p. 2875 - 2877 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |