Silane, azidotriphenyl- structure
|
Common Name | Silane, azidotriphenyl- | ||
|---|---|---|---|---|
| CAS Number | 5599-34-8 | Molecular Weight | 301.41700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H15N3Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | azido(triphenyl)silane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H15N3Si |
|---|---|
| Molecular Weight | 301.41700 |
| Exact Mass | 301.10400 |
| PSA | 49.75000 |
| LogP | 2.41656 |
| InChIKey | CUCDHIYTCSBMGZ-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=N[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
|
~84%
Silane, azidotr... CAS#:5599-34-8 |
| Literature: Fletcher; James C. Administrator of the National Aeronautics and Space Administration, with respect to an invention of; Paciorek; Kazimiera J. L. Patent: US4168287 A1, 1979 ; |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| triphenylsilylazide |
| Azidotriphenylsilan |
| Triphenyl-azido-silan |
| Silane,azidotriphenyl |
| Azidotriphenylsilane |