1,5-Pentanediyl Bismethanethiosulfonate
1,5-Pentanediyl Bismethanethiosulfonate structure
|
Common Name | 1,5-Pentanediyl Bismethanethiosulfonate | ||
|---|---|---|---|---|
| CAS Number | 56-00-8 | Molecular Weight | 292.46000 | |
| Density | 1.366g/cm3 | Boiling Point | 529.5ºC at 760 mmHg | |
| Molecular Formula | C7H16O4S4 | Melting Point | 71-72ºC | |
| MSDS | N/A | Flash Point | 274ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,5-bis(methylsulfonylsulfanyl)pentane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.366g/cm3 |
|---|---|
| Boiling Point | 529.5ºC at 760 mmHg |
| Melting Point | 71-72ºC |
| Molecular Formula | C7H16O4S4 |
| Molecular Weight | 292.46000 |
| Flash Point | 274ºC |
| Exact Mass | 291.99300 |
| PSA | 135.64000 |
| LogP | 3.70390 |
| Index of Refraction | 1.549 |
| InChIKey | PFGFBHYQVVHELE-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)SCCCCCSS(C)(=O)=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1,5-Pentanediyl... CAS#:56-00-8 |
| Literature: EP966304 B1, ; Page/Page column 20 ; |
|
~%
1,5-Pentanediyl... CAS#:56-00-8 |
| Literature: Chemical and pharmaceutical bulletin, , vol. 12, # 11 p. 1271 - 1276 |
|
~%
1,5-Pentanediyl... CAS#:56-00-8 |
| Literature: J. Gen. Chem. USSR (Engl. Transl.), , vol. 33, p. 1980 - 1983,1926 - 1928 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Dimethanesulfonylthiopentane |
| Methanesulfonothioic acid S,S'-1,5-pentanediyl ester |
| MTS-5-MTS |
| Pentamethylene bismethanethiosulfonate |
| 1,5-Bis-methansulfonylthio-pentan |
| 1,5-Pentanediyl Bismethanethiosulfonate |
| Preparation 335 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1,5-bis(methylsulfonylsulfanyl)pentane? |
| A: The English name of 1,5-bis(methylsulfonylsulfanyl)pentane is 1,5-bis(methylsulfonylsulfanyl)pentane. |
| Q: What is the InChIKey of 1,5-bis(methylsulfonylsulfanyl)pentane? |
| A: InChIKey of 1,5-bis(methylsulfonylsulfanyl)pentane is PFGFBHYQVVHELE-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1,5-bis(methylsulfonylsulfanyl)pentane? |
| A: CAS number of 1,5-bis(methylsulfonylsulfanyl)pentane is 56-00-8. |
| Q: What are the upstream materials of 1,5-bis(methylsulfonylsulfanyl)pentane? |
| A: Related upstream materials(CAS) of 1,5-bis(methylsulfonylsulfanyl)pentane: 111-24-0;1950-85-2;6340-98-3. |
| Q: What is the molecular formula of 1,5-bis(methylsulfonylsulfanyl)pentane? |
| A: Molecular formula of 1,5-bis(methylsulfonylsulfanyl)pentane is C7H16O4S4. |
| Q: What is the SMILES notation of 1,5-bis(methylsulfonylsulfanyl)pentane? |
| A: SMILES notation of 1,5-bis(methylsulfonylsulfanyl)pentane is CS(=O)(=O)SCCCCCSS(C)(=O)=O. |
| Q: What is the boiling point of 1,5-bis(methylsulfonylsulfanyl)pentane? |
| A: Boiling point of 1,5-bis(methylsulfonylsulfanyl)pentane is 529.5ºC at 760 mmHg. |
| Q: What is the melting point of 1,5-bis(methylsulfonylsulfanyl)pentane? |
| A: Melting point of 1,5-bis(methylsulfonylsulfanyl)pentane is 71-72ºC. |
| Q: What is the LogP of 1,5-bis(methylsulfonylsulfanyl)pentane? |
| A: LogP of 1,5-bis(methylsulfonylsulfanyl)pentane is 3.70390. |
| Q: What English synonyms does 1,5-bis(methylsulfonylsulfanyl)pentane have? |
| A: English synonyms of 1,5-bis(methylsulfonylsulfanyl)pentane: Dimethanesulfonylthiopentane, Methanesulfonothioic acid S,S'-1,5-pentanediyl ester, MTS-5-MTS, Pentamethylene bismethanethiosulfonate, 1,5-Bis-methansulfonylthio-pentan, 1,5-Pentanediyl Bismethanethiosulfonate, Preparation 335. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |