1,6-Hexanediyl Bismethanethiosulfonate
Modify Date: 2025-10-04 00:40:16
1,6-Hexanediyl Bismethanethiosulfonate structure
|
Common Name | 1,6-Hexanediyl Bismethanethiosulfonate | ||
|---|---|---|---|---|
| CAS Number | 56-01-9 | Molecular Weight | 306.48600 | |
| Density | 1.329g/cm3 | Boiling Point | 533.8ºC at 760 mmHg | |
| Molecular Formula | C8H18O4S4 | Melting Point | 81-82ºC | |
| MSDS | N/A | Flash Point | 276.7ºC | |
| Name | 1,6-Hexanediyl Bismethanethiosulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.329g/cm3 |
|---|---|
| Boiling Point | 533.8ºC at 760 mmHg |
| Melting Point | 81-82ºC |
| Molecular Formula | C8H18O4S4 |
| Molecular Weight | 306.48600 |
| Flash Point | 276.7ºC |
| Exact Mass | 306.00900 |
| PSA | 135.64000 |
| LogP | 4.09400 |
| Index of Refraction | 1.543 |
| InChIKey | JIOMRMVPHYQHQG-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)SCCCCCCSS(C)(=O)=O |
| HS Code | 2930909090 |
|---|
|
~%
1,6-Hexanediyl ... CAS#:56-01-9 |
| Literature: Hayashi; Ueki; Harano; Komiya; Iyama Chemical and pharmaceutical bulletin, 1964 , vol. 12, # 11 p. 1271 - 1276 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:1191-43-1| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1,6-bis(methylsulfonylsulfanyl)hexane |