1,10-Decadiyl Bismethanethiosulfonate
1,10-Decadiyl Bismethanethiosulfonate structure
|
Common Name | 1,10-Decadiyl Bismethanethiosulfonate | ||
|---|---|---|---|---|
| CAS Number | 56-02-0 | Molecular Weight | 362.59200 | |
| Density | 1.222g/cm3 | Boiling Point | 564.1ºC at 760 mmHg | |
| Molecular Formula | C12H26O4S4 | Melting Point | 91-93ºC | |
| MSDS | N/A | Flash Point | 295ºC | |
Summary: 1,10-Decadiyl Bismethanethiosulfonate, Chinese name: 1,10-癸二基二甲烷硫代磺酸酯, CAS number: 56-02-0, molecular formula: C12H26O4S4, molecular weight: 362.59200. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,10-Decadiyl Bismethanethiosulfonate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.222g/cm3 |
|---|---|
| Boiling Point | 564.1ºC at 760 mmHg |
| Melting Point | 91-93ºC |
| Molecular Formula | C12H26O4S4 |
| Molecular Weight | 362.59200 |
| Flash Point | 295ºC |
| Exact Mass | 362.07100 |
| PSA | 135.64000 |
| LogP | 5.65440 |
| Index of Refraction | 1.527 |
| InChIKey | VANCBNNGOYOQGY-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)SCCCCCCCCCCSS(C)(=O)=O |
| Storage condition | -20°C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1,10-Decadiyl B... CAS#:56-02-0 |
| Literature: Hayashi; Ueki; Harano; Komiya; Iyama Chemical and pharmaceutical bulletin, 1964 , vol. 12, # 11 p. 1271 - 1276 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,10-bis(methylsulfonylsulfanyl)decane |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the storage conditions for 1,10-Decadiyl Bismethanethiosulfonate? |
| A: Storage conditions for 1,10-Decadiyl Bismethanethiosulfonate: -20°C. |
| Q: What is the English name of 1,10-Decadiyl Bismethanethiosulfonate? |
| A: The English name of 1,10-Decadiyl Bismethanethiosulfonate is 1,10-Decadiyl Bismethanethiosulfonate. |
| Q: What is the molecular weight of 1,10-Decadiyl Bismethanethiosulfonate? |
| A: Molecular weight of 1,10-Decadiyl Bismethanethiosulfonate is 362.59200. |
| Q: What is the CAS number of 1,10-Decadiyl Bismethanethiosulfonate? |
| A: CAS number of 1,10-Decadiyl Bismethanethiosulfonate is 56-02-0. |
| Q: What are the upstream materials of 1,10-Decadiyl Bismethanethiosulfonate? |
| A: Related upstream materials(CAS) of 1,10-Decadiyl Bismethanethiosulfonate: 1950-85-2;4101-68-2. |
| Q: What is the SMILES notation of 1,10-Decadiyl Bismethanethiosulfonate? |
| A: SMILES notation of 1,10-Decadiyl Bismethanethiosulfonate is CS(=O)(=O)SCCCCCCCCCCSS(C)(=O)=O. |
| Q: What is the melting point of 1,10-Decadiyl Bismethanethiosulfonate? |
| A: Melting point of 1,10-Decadiyl Bismethanethiosulfonate is 91-93ºC. |
| Q: What is the LogP of 1,10-Decadiyl Bismethanethiosulfonate? |
| A: LogP of 1,10-Decadiyl Bismethanethiosulfonate is 5.65440. |
| Q: What is the molecular formula of 1,10-Decadiyl Bismethanethiosulfonate? |
| A: Molecular formula of 1,10-Decadiyl Bismethanethiosulfonate is C12H26O4S4. |
| Q: What English synonyms does 1,10-Decadiyl Bismethanethiosulfonate have? |
| A: English synonyms of 1,10-Decadiyl Bismethanethiosulfonate: 1,10-bis(methylsulfonylsulfanyl)decane. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |