1,10-Decadiyl Bismethanethiosulfonate structure
|
Common Name | 1,10-Decadiyl Bismethanethiosulfonate | ||
|---|---|---|---|---|
| CAS Number | 56-02-0 | Molecular Weight | 362.59200 | |
| Density | 1.222g/cm3 | Boiling Point | 564.1ºC at 760 mmHg | |
| Molecular Formula | C12H26O4S4 | Melting Point | 91-93ºC | |
| MSDS | N/A | Flash Point | 295ºC | |
| Name | 1,10-Decadiyl Bismethanethiosulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.222g/cm3 |
|---|---|
| Boiling Point | 564.1ºC at 760 mmHg |
| Melting Point | 91-93ºC |
| Molecular Formula | C12H26O4S4 |
| Molecular Weight | 362.59200 |
| Flash Point | 295ºC |
| Exact Mass | 362.07100 |
| PSA | 135.64000 |
| LogP | 5.65440 |
| Index of Refraction | 1.527 |
| InChIKey | VANCBNNGOYOQGY-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)SCCCCCCCCCCSS(C)(=O)=O |
| Storage condition | -20°C |
|
~%
1,10-Decadiyl B... CAS#:56-02-0 |
| Literature: Hayashi; Ueki; Harano; Komiya; Iyama Chemical and pharmaceutical bulletin, 1964 , vol. 12, # 11 p. 1271 - 1276 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,10-bis(methylsulfonylsulfanyl)decane |