Odorobioside G
Modify Date: 2026-08-02 13:10:39
Odorobioside G structure
|
Common Name | Odorobioside G | ||
|---|---|---|---|---|
| CAS Number | 560-70-3 | Molecular Weight | 696.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C36H56O13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Odorobioside G |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C36H56O13 |
|---|---|
| Molecular Weight | 696.8 |
| InChIKey | LBCSKUSUYQVKDB-FEFGAQLCSA-N |
| SMILES | COC1C(O)C(OC2CCC3(C)C(CCC4C3CCC3(C)C(C5=CC(=O)OC5)CCC43O)C2)OC(C)C1OC1OC(CO)C(O)C(O)C1O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Odorobioside G? |
| A: Molecular weight of Odorobioside G is 696.8. |
| Q: What is the Chinese name of 560-70-3? |
| A: Chinese name of 560-70-3 is 560-70-3. |
| Q: What is the CAS number of Odorobioside G? |
| A: CAS number of Odorobioside G is 560-70-3. |
| Q: What is the English name of Odorobioside G? |
| A: The English name of Odorobioside G is Odorobioside G. |
| Q: What is the InChIKey of Odorobioside G? |
| A: InChIKey of Odorobioside G is LBCSKUSUYQVKDB-FEFGAQLCSA-N. |
| Q: What is the SMILES notation of Odorobioside G? |
| A: SMILES notation of Odorobioside G is COC1C(O)C(OC2CCC3(C)C(CCC4C3CCC3(C)C(C5=CC(=O)OC5)CCC43O)C2)OC(C)C1OC1OC(CO)C(O)C(O)C1O. |
| Q: What is the molecular formula of Odorobioside G? |
| A: Molecular formula of Odorobioside G is C36H56O13. |