2-N,2-N,4-N,4-N-tetraethyl-1,3,5-triazine-2,4,6-triamine structure
|
Common Name | 2-N,2-N,4-N,4-N-tetraethyl-1,3,5-triazine-2,4,6-triamine | ||
|---|---|---|---|---|
| CAS Number | 5606-20-2 | Molecular Weight | 238.33300 | |
| Density | 1.116g/cm3 | Boiling Point | 406.1ºC at 760 mmHg | |
| Molecular Formula | C11H22N6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.4ºC | |
| Name | 2-N,2-N,4-N,4-N-tetraethyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.116g/cm3 |
|---|---|
| Boiling Point | 406.1ºC at 760 mmHg |
| Molecular Formula | C11H22N6 |
| Molecular Weight | 238.33300 |
| Flash Point | 199.4ºC |
| Exact Mass | 238.19100 |
| PSA | 71.90000 |
| LogP | 1.07630 |
| Index of Refraction | 1.589 |
| InChIKey | VJOHPAMUAGYVFA-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1nc(N)nc(N(CC)CC)n1 |
| HS Code | 2933699090 |
|---|
|
~%
2-N,2-N,4-N,4-N... CAS#:5606-20-2 |
| Literature: Kaiser et al. Journal of the American Chemical Society, 1951 , vol. 73, p. 2984 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| N4,N4,N6,N6-TETRAETHYL-1,3,5-TRIAZINE-2,4,6-TRIAMINE |
| 2-Amino-4,6-bis-<diethylamino>-s-triazin |