N-(4-(3-amino-4-nitrophenylthio)phenyl)acetamide
N-(4-(3-amino-4-nitrophenylthio)phenyl)acetamide structure
|
Common Name | N-(4-(3-amino-4-nitrophenylthio)phenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 56073-93-9 | Molecular Weight | 303.33600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H13N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-(4-acetamidothiophenoxy)-2-nitroaniline |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H13N3O3S |
|---|---|
| Molecular Weight | 303.33600 |
| Exact Mass | 303.06800 |
| PSA | 126.24000 |
| LogP | 4.46400 |
| InChIKey | PZQALCYFGACCLO-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(Sc2ccc([N+](=O)[O-])c(N)c2)cc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
![N-[6-[(4-AMINOPHENYL)THIO]-1H-BENZIMIDAZOL-2-YL]-CARBAMIC ACID METHYL ESTER structure](https://image.chemsrc.com/caspic/064/56073-96-2.png)
CAS#:56073-96-2![5-[[4-(ACETYLAMINO)PHENYL]THIO]-1H-BENZIMIDAZOL-2-YL]-CARBAMIC ACID METHYL ESTER structure](https://image.chemsrc.com/caspic/102/56073-95-1.png)
CAS#:56073-95-1This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-Amino-4-nitro-4'-acetamidodiphenylsulfid |
| 2-amino-4-(4-acetamidophenylsulphanyl)nitrobenzene |
| 5-(4-acetamidophenylthio)-2-nitroaniline |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 5-(4-acetamidothiophenoxy)-2-nitroaniline? |
| A: InChIKey of 5-(4-acetamidothiophenoxy)-2-nitroaniline is PZQALCYFGACCLO-UHFFFAOYSA-N. |
| Q: What is the CAS number of 5-(4-acetamidothiophenoxy)-2-nitroaniline? |
| A: CAS number of 5-(4-acetamidothiophenoxy)-2-nitroaniline is 56073-93-9. |
| Q: What is the LogP of 5-(4-acetamidothiophenoxy)-2-nitroaniline? |
| A: LogP of 5-(4-acetamidothiophenoxy)-2-nitroaniline is 4.46400. |
| Q: What is the SMILES notation of 5-(4-acetamidothiophenoxy)-2-nitroaniline? |
| A: SMILES notation of 5-(4-acetamidothiophenoxy)-2-nitroaniline is CC(=O)Nc1ccc(Sc2ccc([N+](=O)[O-])c(N)c2)cc1. |
| Q: What English synonyms does 5-(4-acetamidothiophenoxy)-2-nitroaniline have? |
| A: English synonyms of 5-(4-acetamidothiophenoxy)-2-nitroaniline: 3-Amino-4-nitro-4'-acetamidodiphenylsulfid, 2-amino-4-(4-acetamidophenylsulphanyl)nitrobenzene, 5-(4-acetamidophenylthio)-2-nitroaniline. |
| Q: What is the molecular formula of 5-(4-acetamidothiophenoxy)-2-nitroaniline? |
| A: Molecular formula of 5-(4-acetamidothiophenoxy)-2-nitroaniline is C14H13N3O3S. |
| Q: What is the polar surface area (PSA) of 5-(4-acetamidothiophenoxy)-2-nitroaniline? |
| A: Polar surface area (PSA) of 5-(4-acetamidothiophenoxy)-2-nitroaniline is 126.24000. |
| Q: What are the downstream products of 5-(4-acetamidothiophenoxy)-2-nitroaniline? |
| A: Related downstream products(CAS) of 5-(4-acetamidothiophenoxy)-2-nitroaniline: 56073-96-2;56073-95-1. |
| Q: What is the English name of 5-(4-acetamidothiophenoxy)-2-nitroaniline? |
| A: The English name of 5-(4-acetamidothiophenoxy)-2-nitroaniline is 5-(4-acetamidothiophenoxy)-2-nitroaniline. |
| Q: What is the Chinese name of 56073-93-9? |
| A: Chinese name of 56073-93-9 is 56073-93-9. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |