ROPITOIN structure
|
Common Name | ROPITOIN | ||
|---|---|---|---|---|
| CAS Number | 56079-81-3 | Molecular Weight | 483.60100 | |
| Density | 1.175g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C30H33N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of ROPITOINRopitoin (TR 2985) is a novel antiarrhythmic drug. |
| Name | 5-(4-methoxyphenyl)-5-phenyl-3-[3-(4-phenylpiperidin-1-yl)propyl]imidazolidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Description | Ropitoin (TR 2985) is a novel antiarrhythmic drug. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.175g/cm3 |
|---|---|
| Molecular Formula | C30H33N3O3 |
| Molecular Weight | 483.60100 |
| Exact Mass | 483.25200 |
| PSA | 65.37000 |
| LogP | 4.27610 |
| Index of Refraction | 1.593 |
| InChIKey | QAKVGHCHHKKDBQ-UHFFFAOYSA-N |
| SMILES | COc1ccc(C2(c3ccccc3)NC(=O)N(CCCN3CCC(c4ccccc4)CC3)C2=O)cc1 |
| Storage condition | 2-8℃ |
| Ropitoina |
| 5-(4-Methoxyphenyl)-5-phenyl-3-(3-(4-phenylpiperidino)propyl)-2,4-imidazolidindion |
| 5-(p-Methoxyphenyl)-5-phenyl-3-(3-(4-phenylpiperidino)propyl)hydantoin |
| UNII-417FG5371N |
| Ropitoin [INN] |
| Ropitoinum |
| 5-(4-methoxy-phenyl)-5-phenyl-3-[3-(4-phenyl-piperidin-1-yl)-propyl]-imidazolidine-2,4-dione |
| ROPITOIN |
| 3-[3-(4-phenyl-1-piperidyl)propyl]-5-(4-methoxyphenyl)-5-phenylhydantoin |